C14H15IN4O3 — CID 169404077
5-(3-ethoxy-5-iodo-4-prop-2-enoxyphenyl)-2H-triazole-4-carboxamide (PubChem CID 169404077) has the molecular formula C14H15IN4O3 and a molecular weight of 414.20 g/mol. Its IUPAC name is 5-(3-ethoxy-5-iodo-4-prop-2-enoxyphenyl)-2H-triazole-4-carboxamide.
| Compound Name | 5-(3-ethoxy-5-iodo-4-prop-2-enoxyphenyl)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169404077 |
| Molecular Formula | C14H15IN4O3 |
| Molecular Weight | 414.20 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | 5-(3-ethoxy-5-iodo-4-prop-2-enoxyphenyl)-2H-triazole-4-carboxamide |
| SMILES | C=CCOc1c(I)cc(-c2n[nH]nc2C(N)=O)cc1OCC |
| InChI | InChI=1S/C14H15IN4O3/c1-3-5-22-13-9(15)6-8(7-10(13)21-4-2)11-12(14(16)20)18-19-17-11/h3,6-7H,1,4-5H2,2H3,(H2,16,20)(H,17,18,19) |
| InChIKey | OECRUEYSWSYEJU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.20 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|