C12H12IO4- — CID 8707183
3-ethoxy-5-iodo-4-prop-2-enoxybenzoate (PubChem CID 8707183) has the molecular formula C12H12IO4- and a molecular weight of 347.13 g/mol. Its IUPAC name is 3-ethoxy-5-iodo-4-prop-2-enoxybenzoate.
| Compound Name | 3-ethoxy-5-iodo-4-prop-2-enoxybenzoate |
|---|---|
| PubChem CID | 8707183 |
| Molecular Formula | C12H12IO4- |
| Molecular Weight | 347.13 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | 3-ethoxy-5-iodo-4-prop-2-enoxybenzoate |
| SMILES | C=CCOc1c(I)cc(C(=O)[O-])cc1OCC |
| InChI | InChI=1S/C12H13IO4/c1-3-5-17-11-9(13)6-8(12(14)15)7-10(11)16-4-2/h3,6-7H,1,4-5H2,2H3,(H,14,15)/p-1 |
| InChIKey | OKHRIBQKRWQGQW-UHFFFAOYSA-M |
| XLogP | 1.62 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.13 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|