C23H26IN3O6 — CID 126319007
N-[(E)-[4-(2-amino-2-oxoethoxy)-3-ethoxy-5-iodophenyl]methylideneamino]-3-ethoxy-4-prop-2-enoxybenzamide (PubChem CID 126319007) has the molecular formula C23H26IN3O6 and a molecular weight of 567.38 g/mol. Its IUPAC name is N-[(E)-[4-(2-amino-2-oxoethoxy)-3-ethoxy-5-iodophenyl]methylideneamino]-3-ethoxy-4-prop-2-enoxybenzamide.
| Compound Name | N-[(E)-[4-(2-amino-2-oxoethoxy)-3-ethoxy-5-iodophenyl]methylideneamino]-3-ethoxy-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 126319007 |
| Molecular Formula | C23H26IN3O6 |
| Molecular Weight | 567.38 g/mol |
| Exact Mass | 567.09 |
| IUPAC Name | N-[(E)-[4-(2-amino-2-oxoethoxy)-3-ethoxy-5-iodophenyl]methylideneamino]-3-ethoxy-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)N/N=C/c2cc(I)c(OCC(N)=O)c(OCC)c2)cc1OCC |
| InChI | InChI=1S/C23H26IN3O6/c1-4-9-32-18-8-7-16(12-19(18)30-5-2)23(29)27-26-13-15-10-17(24)22(33-14-21(25)28)20(11-15)31-6-3/h4,7-8,10-13H,1,5-6,9,14H2,2-3H3,(H2,25,28)(H,27,29)/b26-13+ |
| InChIKey | NXHSMZNWDYESRM-LGJNPRDNSA-N |
| XLogP | 3.28 |
| TPSA | 121.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|