C22H24N2O4 — CID 126336930
3-ethoxy-4-prop-2-enoxy-N-[(E)-(4-prop-2-enoxyphenyl)methylideneamino]benzamide (PubChem CID 126336930) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 3-ethoxy-4-prop-2-enoxy-N-[(E)-(4-prop-2-enoxyphenyl)methylideneamino]benzamide.
| Compound Name | 3-ethoxy-4-prop-2-enoxy-N-[(E)-(4-prop-2-enoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 126336930 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 3-ethoxy-4-prop-2-enoxy-N-[(E)-(4-prop-2-enoxyphenyl)methylideneamino]benzamide |
| SMILES | C=CCOc1ccc(/C=N/NC(=O)c2ccc(OCC=C)c(OCC)c2)cc1 |
| InChI | InChI=1S/C22H24N2O4/c1-4-13-27-19-10-7-17(8-11-19)16-23-24-22(25)18-9-12-20(28-14-5-2)21(15-18)26-6-3/h4-5,7-12,15-16H,1-2,6,13-14H2,3H3,(H,24,25)/b23-16+ |
| InChIKey | BIKQDDPTHIPARD-XQNSMLJCSA-N |
| XLogP | 3.98 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|