C21H25IN2O5 — CID 126329810
3-ethoxy-N-[(E)-(3-iodo-5-methoxy-4-propoxyphenyl)methylideneamino]-4-methoxybenzamide (PubChem CID 126329810) has the molecular formula C21H25IN2O5 and a molecular weight of 512.34 g/mol. Its IUPAC name is 3-ethoxy-N-[(E)-(3-iodo-5-methoxy-4-propoxyphenyl)methylideneamino]-4-methoxybenzamide.
| Compound Name | 3-ethoxy-N-[(E)-(3-iodo-5-methoxy-4-propoxyphenyl)methylideneamino]-4-methoxybenzamide |
|---|---|
| PubChem CID | 126329810 |
| Molecular Formula | C21H25IN2O5 |
| Molecular Weight | 512.34 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | 3-ethoxy-N-[(E)-(3-iodo-5-methoxy-4-propoxyphenyl)methylideneamino]-4-methoxybenzamide |
| SMILES | CCCOc1c(I)cc(/C=N/NC(=O)c2ccc(OC)c(OCC)c2)cc1OC |
| InChI | InChI=1S/C21H25IN2O5/c1-5-9-29-20-16(22)10-14(11-19(20)27-4)13-23-24-21(25)15-7-8-17(26-3)18(12-15)28-6-2/h7-8,10-13H,5-6,9H2,1-4H3,(H,24,25)/b23-13+ |
| InChIKey | OYFCJGJJBHZLAH-YDZHTSKRSA-N |
| XLogP | 4.26 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|