C20H23IN2O4 — CID 29148846
4-ethoxy-N-[(Z)-(3-iodo-5-methoxy-4-propoxyphenyl)methylideneamino]benzamide (PubChem CID 29148846) has the molecular formula C20H23IN2O4 and a molecular weight of 482.32 g/mol. Its IUPAC name is 4-ethoxy-N-[(Z)-(3-iodo-5-methoxy-4-propoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-ethoxy-N-[(Z)-(3-iodo-5-methoxy-4-propoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 29148846 |
| Molecular Formula | C20H23IN2O4 |
| Molecular Weight | 482.32 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | 4-ethoxy-N-[(Z)-(3-iodo-5-methoxy-4-propoxyphenyl)methylideneamino]benzamide |
| SMILES | CCCOc1c(I)cc(/C=N\NC(=O)c2ccc(OCC)cc2)cc1OC |
| InChI | InChI=1S/C20H23IN2O4/c1-4-10-27-19-17(21)11-14(12-18(19)25-3)13-22-23-20(24)15-6-8-16(9-7-15)26-5-2/h6-9,11-13H,4-5,10H2,1-3H3,(H,23,24)/b22-13- |
| InChIKey | XMPOWXZHLFDFHI-XKZIYDEJSA-N |
| XLogP | 4.25 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.32 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|