C28H32IN3O5 — CID 4988986
N-[[4-[2-(4-hexoxyphenoxy)ethoxy]-3-iodo-5-methoxyphenyl]methylideneamino]pyridine-4-carboxamide (PubChem CID 4988986) has the molecular formula C28H32IN3O5 and a molecular weight of 617.48 g/mol. Its IUPAC name is N-[[4-[2-(4-hexoxyphenoxy)ethoxy]-3-iodo-5-methoxyphenyl]methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[[4-[2-(4-hexoxyphenoxy)ethoxy]-3-iodo-5-methoxyphenyl]methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 4988986 |
| Molecular Formula | C28H32IN3O5 |
| Molecular Weight | 617.48 g/mol |
| Exact Mass | 617.14 |
| IUPAC Name | N-[[4-[2-(4-hexoxyphenoxy)ethoxy]-3-iodo-5-methoxyphenyl]methylideneamino]pyridine-4-carboxamide |
| SMILES | CCCCCCOc1ccc(OCCOc2c(I)cc(C=NNC(=O)c3ccncc3)cc2OC)cc1 |
| InChI | InChI=1S/C28H32IN3O5/c1-3-4-5-6-15-35-23-7-9-24(10-8-23)36-16-17-37-27-25(29)18-21(19-26(27)34-2)20-31-32-28(33)22-11-13-30-14-12-22/h7-14,18-20H,3-6,15-17H2,1-2H3,(H,32,33) |
| InChIKey | PWQAFBZFXJFLBI-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 91.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.48 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|