C23H28BrClN2O3 — CID 5184959
4-bromo-N-[(3-chloro-5-methoxy-4-octoxyphenyl)methylideneamino]benzamide (PubChem CID 5184959) has the molecular formula C23H28BrClN2O3 and a molecular weight of 495.85 g/mol. Its IUPAC name is 4-bromo-N-[(3-chloro-5-methoxy-4-octoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-bromo-N-[(3-chloro-5-methoxy-4-octoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 5184959 |
| Molecular Formula | C23H28BrClN2O3 |
| Molecular Weight | 495.85 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | 4-bromo-N-[(3-chloro-5-methoxy-4-octoxyphenyl)methylideneamino]benzamide |
| SMILES | CCCCCCCCOc1c(Cl)cc(C=NNC(=O)c2ccc(Br)cc2)cc1OC |
| InChI | InChI=1S/C23H28BrClN2O3/c1-3-4-5-6-7-8-13-30-22-20(25)14-17(15-21(22)29-2)16-26-27-23(28)18-9-11-19(24)12-10-18/h9-12,14-16H,3-8,13H2,1-2H3,(H,27,28) |
| InChIKey | FNRZLQAHMVWOOI-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.85 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|