C30H26BrClN2O5 — CID 126329308
N-[(E)-[4-[(4-bromophenyl)methoxy]-3-chloro-5-methoxyphenyl]methylideneamino]-3-methoxy-4-phenylmethoxybenzamide (PubChem CID 126329308) has the molecular formula C30H26BrClN2O5 and a molecular weight of 609.90 g/mol. Its IUPAC name is N-[(E)-[4-[(4-bromophenyl)methoxy]-3-chloro-5-methoxyphenyl]methylideneamino]-3-methoxy-4-phenylmethoxybenzamide.
| Compound Name | N-[(E)-[4-[(4-bromophenyl)methoxy]-3-chloro-5-methoxyphenyl]methylideneamino]-3-methoxy-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 126329308 |
| Molecular Formula | C30H26BrClN2O5 |
| Molecular Weight | 609.90 g/mol |
| Exact Mass | 608.07 |
| IUPAC Name | N-[(E)-[4-[(4-bromophenyl)methoxy]-3-chloro-5-methoxyphenyl]methylideneamino]-3-methoxy-4-phenylmethoxybenzamide |
| SMILES | COc1cc(C(=O)N/N=C/c2cc(Cl)c(OCc3ccc(Br)cc3)c(OC)c2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C30H26BrClN2O5/c1-36-27-16-23(10-13-26(27)38-18-20-6-4-3-5-7-20)30(35)34-33-17-22-14-25(32)29(28(15-22)37-2)39-19-21-8-11-24(31)12-9-21/h3-17H,18-19H2,1-2H3,(H,34,35)/b33-17+ |
| InChIKey | ODPWWVGHFSHOGV-ATZGPIRCSA-N |
| XLogP | 7.04 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.90 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|