C22H19Br2N3O4 — CID 5175553
N-[[3-bromo-4-[2-(4-bromophenoxy)ethoxy]-5-methoxyphenyl]methylideneamino]pyridine-4-carboxamide (PubChem CID 5175553) has the molecular formula C22H19Br2N3O4 and a molecular weight of 549.22 g/mol. Its IUPAC name is N-[[3-bromo-4-[2-(4-bromophenoxy)ethoxy]-5-methoxyphenyl]methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[[3-bromo-4-[2-(4-bromophenoxy)ethoxy]-5-methoxyphenyl]methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 5175553 |
| Molecular Formula | C22H19Br2N3O4 |
| Molecular Weight | 549.22 g/mol |
| Exact Mass | 546.97 |
| IUPAC Name | N-[[3-bromo-4-[2-(4-bromophenoxy)ethoxy]-5-methoxyphenyl]methylideneamino]pyridine-4-carboxamide |
| SMILES | COc1cc(C=NNC(=O)c2ccncc2)cc(Br)c1OCCOc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H19Br2N3O4/c1-29-20-13-15(14-26-27-22(28)16-6-8-25-9-7-16)12-19(24)21(20)31-11-10-30-18-4-2-17(23)3-5-18/h2-9,12-14H,10-11H2,1H3,(H,27,28) |
| InChIKey | ZIWMOWJSSZVSPF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.22 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|