C24H23ClIN3O4 — CID 171987893
N-[(E)-[4-[2-(4-chloro-2-methylphenoxy)ethoxy]-3-ethoxy-5-iodophenyl]methylideneamino]pyridine-4-carboxamide (PubChem CID 171987893) has the molecular formula C24H23ClIN3O4 and a molecular weight of 579.82 g/mol. Its IUPAC name is N-[(E)-[4-[2-(4-chloro-2-methylphenoxy)ethoxy]-3-ethoxy-5-iodophenyl]methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-[4-[2-(4-chloro-2-methylphenoxy)ethoxy]-3-ethoxy-5-iodophenyl]methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 171987893 |
| Molecular Formula | C24H23ClIN3O4 |
| Molecular Weight | 579.82 g/mol |
| Exact Mass | 579.04 |
| IUPAC Name | N-[(E)-[4-[2-(4-chloro-2-methylphenoxy)ethoxy]-3-ethoxy-5-iodophenyl]methylideneamino]pyridine-4-carboxamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccncc2)cc(I)c1OCCOc1ccc(Cl)cc1C |
| InChI | InChI=1S/C24H23ClIN3O4/c1-3-31-22-14-17(15-28-29-24(30)18-6-8-27-9-7-18)13-20(26)23(22)33-11-10-32-21-5-4-19(25)12-16(21)2/h4-9,12-15H,3,10-11H2,1-2H3,(H,29,30)/b28-15+ |
| InChIKey | PTRRBTQTHRNJLW-RWPZCVJISA-N |
| XLogP | 5.27 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.82 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|