C9H8I2O3 — CID 91972425
4-ethoxy-3,5-diiodobenzoic acid (PubChem CID 91972425) has the molecular formula C9H8I2O3 and a molecular weight of 417.97 g/mol. Its IUPAC name is 4-ethoxy-3,5-diiodobenzoic acid.
| Compound Name | 4-ethoxy-3,5-diiodobenzoic acid |
|---|---|
| PubChem CID | 91972425 |
| Molecular Formula | C9H8I2O3 |
| Molecular Weight | 417.97 g/mol |
| Exact Mass | 417.86 |
| IUPAC Name | 4-ethoxy-3,5-diiodobenzoic acid |
| SMILES | CCOc1c(I)cc(C(=O)O)cc1I |
| InChI | InChI=1S/C9H8I2O3/c1-2-14-8-6(10)3-5(9(12)13)4-7(8)11/h3-4H,2H2,1H3,(H,12,13) |
| InChIKey | RVHJWUJWRPUGQC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.97 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|