C8H8I2O — CID 165359155
2-ethoxy-1,3-diiodobenzene (PubChem CID 165359155) has the molecular formula C8H8I2O and a molecular weight of 373.96 g/mol. Its IUPAC name is 2-ethoxy-1,3-diiodobenzene.
| Compound Name | 2-ethoxy-1,3-diiodobenzene |
|---|---|
| PubChem CID | 165359155 |
| Molecular Formula | C8H8I2O |
| Molecular Weight | 373.96 g/mol |
| Exact Mass | 373.87 |
| IUPAC Name | 2-ethoxy-1,3-diiodobenzene |
| SMILES | CCOc1c(I)cccc1I |
| InChI | InChI=1S/C8H8I2O/c1-2-11-8-6(9)4-3-5-7(8)10/h3-5H,2H2,1H3 |
| InChIKey | SQHDHKVGQHFISM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.96 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|