About 2-ethoxy-6-iodophenol
2-ethoxy-6-iodophenol (PubChem CID 171366674) has the molecular formula C8H9IO2
and a molecular weight of 264.06 g/mol. Its IUPAC name is 2-ethoxy-6-iodophenol.
Molecular Properties
| Compound Name | 2-ethoxy-6-iodophenol |
| PubChem CID | 171366674 |
| Molecular Formula | C8H9IO2 |
| Molecular Weight | 264.06 g/mol |
| Exact Mass | 263.96 |
| IUPAC Name | 2-ethoxy-6-iodophenol |
| SMILES | CCOc1cccc(I)c1O |
| InChI | InChI=1S/C8H9IO2/c1-2-11-7-5-3-4-6(9)8(7)10/h3-5,10H,2H2,1H3 |
| InChIKey | AVDIQTREEUXGLK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.06 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-6-iodophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-6-iodophenol?
The IUPAC name of 2-ethoxy-6-iodophenol (CID 171366674) is 2-ethoxy-6-iodophenol.
What is the SMILES notation for 2-ethoxy-6-iodophenol?
The canonical SMILES for 2-ethoxy-6-iodophenol is CCOc1cccc(I)c1O.
What is the InChIKey of 2-ethoxy-6-iodophenol?
The InChIKey is AVDIQTREEUXGLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9IO2/c1-2-11-7-5-3-4-6(9)8(7)10/h3-5,10H,2H2,1H3.
What are the key properties of 2-ethoxy-6-iodophenol?
2-ethoxy-6-iodophenol has a molecular weight of 264.06 g/mol, XLogP of 2.40, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-6-iodophenol is sourced from PubChem (CID 171366674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).