C11H16O2S — CID 83930701
2-ethoxy-6-(3-sulfanylpropyl)phenol (PubChem CID 83930701) has the molecular formula C11H16O2S and a molecular weight of 212.31 g/mol. Its IUPAC name is 2-ethoxy-6-(3-sulfanylpropyl)phenol.
| Compound Name | 2-ethoxy-6-(3-sulfanylpropyl)phenol |
|---|---|
| PubChem CID | 83930701 |
| Molecular Formula | C11H16O2S |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 2-ethoxy-6-(3-sulfanylpropyl)phenol |
| SMILES | CCOc1cccc(CCCS)c1O |
| InChI | InChI=1S/C11H16O2S/c1-2-13-10-7-3-5-9(11(10)12)6-4-8-14/h3,5,7,12,14H,2,4,6,8H2,1H3 |
| InChIKey | WONYGGQYVAOQEC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|