C11H15F2NO2 — CID 115405717
2-[(2,2-difluoroethylamino)methyl]-6-ethoxyphenol (PubChem CID 115405717) has the molecular formula C11H15F2NO2 and a molecular weight of 231.24 g/mol. Its IUPAC name is 2-[(2,2-difluoroethylamino)methyl]-6-ethoxyphenol.
| Compound Name | 2-[(2,2-difluoroethylamino)methyl]-6-ethoxyphenol |
|---|---|
| PubChem CID | 115405717 |
| Molecular Formula | C11H15F2NO2 |
| Molecular Weight | 231.24 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 2-[(2,2-difluoroethylamino)methyl]-6-ethoxyphenol |
| SMILES | CCOc1cccc(CNCC(F)F)c1O |
| InChI | InChI=1S/C11H15F2NO2/c1-2-16-9-5-3-4-8(11(9)15)6-14-7-10(12)13/h3-5,10,14-15H,2,6-7H2,1H3 |
| InChIKey | DQDCFULETWPUFY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|