C12H19NO4 — CID 66174868
3-[(3-ethoxy-2-hydroxyphenyl)methylamino]propane-1,2-diol (PubChem CID 66174868) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is 3-[(3-ethoxy-2-hydroxyphenyl)methylamino]propane-1,2-diol.
| Compound Name | 3-[(3-ethoxy-2-hydroxyphenyl)methylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 66174868 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 3-[(3-ethoxy-2-hydroxyphenyl)methylamino]propane-1,2-diol |
| SMILES | CCOc1cccc(CNCC(O)CO)c1O |
| InChI | InChI=1S/C12H19NO4/c1-2-17-11-5-3-4-9(12(11)16)6-13-7-10(15)8-14/h3-5,10,13-16H,2,6-8H2,1H3 |
| InChIKey | GDERUBCBSDBKNU-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|