C12H19NO4 — CID 96915436
(2R)-3-[(2,3-dimethoxyphenyl)methylamino]propane-1,2-diol (PubChem CID 96915436) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is (2R)-3-[(2,3-dimethoxyphenyl)methylamino]propane-1,2-diol.
| Compound Name | (2R)-3-[(2,3-dimethoxyphenyl)methylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 96915436 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | (2R)-3-[(2,3-dimethoxyphenyl)methylamino]propane-1,2-diol |
| SMILES | COc1cccc(CNC[C@@H](O)CO)c1OC |
| InChI | InChI=1S/C12H19NO4/c1-16-11-5-3-4-9(12(11)17-2)6-13-7-10(15)8-14/h3-5,10,13-15H,6-8H2,1-2H3/t10-/m1/s1 |
| InChIKey | PRTUSLHUOYAGQD-SNVBAGLBSA-N |
| XLogP | 0.15 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |