C15H25NO2 — CID 64569277
N-[(2,3-dimethoxyphenyl)methyl]-2,3-dimethylbutan-1-amine (PubChem CID 64569277) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is N-[(2,3-dimethoxyphenyl)methyl]-2,3-dimethylbutan-1-amine.
| Compound Name | N-[(2,3-dimethoxyphenyl)methyl]-2,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 64569277 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | N-[(2,3-dimethoxyphenyl)methyl]-2,3-dimethylbutan-1-amine |
| SMILES | COc1cccc(CNCC(C)C(C)C)c1OC |
| InChI | InChI=1S/C15H25NO2/c1-11(2)12(3)9-16-10-13-7-6-8-14(17-4)15(13)18-5/h6-8,11-12,16H,9-10H2,1-5H3 |
| InChIKey | RSDQMJHICZOZKW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |