C15H25NO4 — CID 10612980
N-[(2,3-dimethoxyphenyl)methyl]-2,2-diethoxyethanamine (PubChem CID 10612980) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is N-[(2,3-dimethoxyphenyl)methyl]-2,2-diethoxyethanamine.
| Compound Name | N-[(2,3-dimethoxyphenyl)methyl]-2,2-diethoxyethanamine |
|---|---|
| PubChem CID | 10612980 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | N-[(2,3-dimethoxyphenyl)methyl]-2,2-diethoxyethanamine |
| SMILES | CCOC(CNCc1cccc(OC)c1OC)OCC |
| InChI | InChI=1S/C15H25NO4/c1-5-19-14(20-6-2)11-16-10-12-8-7-9-13(17-3)15(12)18-4/h7-9,14,16H,5-6,10-11H2,1-4H3 |
| InChIKey | BCQDFNHNUDHENS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|