C15H24BrNO4 — CID 78910427
N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-2,2-diethoxyethanamine (PubChem CID 78910427) has the molecular formula C15H24BrNO4 and a molecular weight of 362.26 g/mol. Its IUPAC name is N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-2,2-diethoxyethanamine.
| Compound Name | N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-2,2-diethoxyethanamine |
|---|---|
| PubChem CID | 78910427 |
| Molecular Formula | C15H24BrNO4 |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-2,2-diethoxyethanamine |
| SMILES | CCOC(CNCc1cc(OC)c(OC)cc1Br)OCC |
| InChI | InChI=1S/C15H24BrNO4/c1-5-20-15(21-6-2)10-17-9-11-7-13(18-3)14(19-4)8-12(11)16/h7-8,15,17H,5-6,9-10H2,1-4H3 |
| InChIKey | NTNGVGLKNQXCRA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|