C16H26BrNO3 — CID 103707845
3-[[(2-bromo-4,5-dimethoxyphenyl)methylamino]methyl]hexan-1-ol (PubChem CID 103707845) has the molecular formula C16H26BrNO3 and a molecular weight of 360.29 g/mol. Its IUPAC name is 3-[[(2-bromo-4,5-dimethoxyphenyl)methylamino]methyl]hexan-1-ol.
| Compound Name | 3-[[(2-bromo-4,5-dimethoxyphenyl)methylamino]methyl]hexan-1-ol |
|---|---|
| PubChem CID | 103707845 |
| Molecular Formula | C16H26BrNO3 |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 3-[[(2-bromo-4,5-dimethoxyphenyl)methylamino]methyl]hexan-1-ol |
| SMILES | CCCC(CCO)CNCc1cc(OC)c(OC)cc1Br |
| InChI | InChI=1S/C16H26BrNO3/c1-4-5-12(6-7-19)10-18-11-13-8-15(20-2)16(21-3)9-14(13)17/h8-9,12,18-19H,4-7,10-11H2,1-3H3 |
| InChIKey | UDDYWLKGAMEYEL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |