C14H22BrNO — CID 111470613
3-[[(4-bromophenyl)methylamino]methyl]hexan-1-ol (PubChem CID 111470613) has the molecular formula C14H22BrNO and a molecular weight of 300.24 g/mol. Its IUPAC name is 3-[[(4-bromophenyl)methylamino]methyl]hexan-1-ol.
| Compound Name | 3-[[(4-bromophenyl)methylamino]methyl]hexan-1-ol |
|---|---|
| PubChem CID | 111470613 |
| Molecular Formula | C14H22BrNO |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 3-[[(4-bromophenyl)methylamino]methyl]hexan-1-ol |
| SMILES | CCCC(CCO)CNCc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H22BrNO/c1-2-3-12(8-9-17)10-16-11-13-4-6-14(15)7-5-13/h4-7,12,16-17H,2-3,8-11H2,1H3 |
| InChIKey | UUPHJDUUZODTAW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |