C13H22N2O — CID 111470632
3-[(pyridin-4-ylmethylamino)methyl]hexan-1-ol (PubChem CID 111470632) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 3-[(pyridin-4-ylmethylamino)methyl]hexan-1-ol.
| Compound Name | 3-[(pyridin-4-ylmethylamino)methyl]hexan-1-ol |
|---|---|
| PubChem CID | 111470632 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 3-[(pyridin-4-ylmethylamino)methyl]hexan-1-ol |
| SMILES | CCCC(CCO)CNCc1ccncc1 |
| InChI | InChI=1S/C13H22N2O/c1-2-3-12(6-9-16)10-15-11-13-4-7-14-8-5-13/h4-5,7-8,12,15-16H,2-3,6,9-11H2,1H3 |
| InChIKey | IKBMTWFZZKYCBJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |