C14H23NO4 — CID 103953592
4-[[2-(2-hydroxyethyl)pentylamino]methyl]benzene-1,2,3-triol (PubChem CID 103953592) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is 4-[[2-(2-hydroxyethyl)pentylamino]methyl]benzene-1,2,3-triol.
| Compound Name | 4-[[2-(2-hydroxyethyl)pentylamino]methyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 103953592 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 4-[[2-(2-hydroxyethyl)pentylamino]methyl]benzene-1,2,3-triol |
| SMILES | CCCC(CCO)CNCc1ccc(O)c(O)c1O |
| InChI | InChI=1S/C14H23NO4/c1-2-3-10(6-7-16)8-15-9-11-4-5-12(17)14(19)13(11)18/h4-5,10,15-19H,2-3,6-9H2,1H3 |
| InChIKey | HOSHKOLPMQGIRA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|