C16H27NO2 — CID 111470622
2-[[2-(2-hydroxyethyl)pentylamino]methyl]-4,5-dimethylphenol (PubChem CID 111470622) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 2-[[2-(2-hydroxyethyl)pentylamino]methyl]-4,5-dimethylphenol.
| Compound Name | 2-[[2-(2-hydroxyethyl)pentylamino]methyl]-4,5-dimethylphenol |
|---|---|
| PubChem CID | 111470622 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 2-[[2-(2-hydroxyethyl)pentylamino]methyl]-4,5-dimethylphenol |
| SMILES | CCCC(CCO)CNCc1cc(C)c(C)cc1O |
| InChI | InChI=1S/C16H27NO2/c1-4-5-14(6-7-18)10-17-11-15-8-12(2)13(3)9-16(15)19/h8-9,14,17-19H,4-7,10-11H2,1-3H3 |
| InChIKey | IOLHIJASRHJLIR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|