C16H27NO — CID 103707961
3-[[(2,5-dimethylphenyl)methylamino]methyl]hexan-1-ol (PubChem CID 103707961) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is 3-[[(2,5-dimethylphenyl)methylamino]methyl]hexan-1-ol.
| Compound Name | 3-[[(2,5-dimethylphenyl)methylamino]methyl]hexan-1-ol |
|---|---|
| PubChem CID | 103707961 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 3-[[(2,5-dimethylphenyl)methylamino]methyl]hexan-1-ol |
| SMILES | CCCC(CCO)CNCc1cc(C)ccc1C |
| InChI | InChI=1S/C16H27NO/c1-4-5-15(8-9-18)11-17-12-16-10-13(2)6-7-14(16)3/h6-7,10,15,17-18H,4-5,8-9,11-12H2,1-3H3 |
| InChIKey | MAIMZPHPFKUKIK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |