About 3-[[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]methyl]hexan-1-ol
3-[[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]methyl]hexan-1-ol (PubChem CID 106115486) has the molecular formula C17H27NO2
and a molecular weight of 277.41 g/mol. Its IUPAC name is 3-[[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]methyl]hexan-1-ol.
Molecular Properties
| Compound Name | 3-[[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]methyl]hexan-1-ol |
| PubChem CID | 106115486 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 3-[[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]methyl]hexan-1-ol |
| SMILES | CCCC(CCO)CNCC1Cc2cc(C)ccc2O1 |
| InChI | InChI=1S/C17H27NO2/c1-3-4-14(7-8-19)11-18-12-16-10-15-9-13(2)5-6-17(15)20-16/h5-6,9,14,16,18-19H,3-4,7-8,10-12H2,1-2H3 |
| InChIKey | MNDLGPVQFMYRDK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]methyl]hexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]methyl]hexan-1-ol?
The IUPAC name of 3-[[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]methyl]hexan-1-ol (CID 106115486) is 3-[[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]methyl]hexan-1-ol.
What is the SMILES notation for 3-[[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]methyl]hexan-1-ol?
The canonical SMILES for 3-[[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]methyl]hexan-1-ol is CCCC(CCO)CNCC1Cc2cc(C)ccc2O1.
What is the InChIKey of 3-[[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]methyl]hexan-1-ol?
The InChIKey is MNDLGPVQFMYRDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO2/c1-3-4-14(7-8-19)11-18-12-16-10-15-9-13(2)5-6-17(15)20-16/h5-6,9,14,16,18-19H,3-4,7-8,10-12H2,1-2H3.
What are the key properties of 3-[[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]methyl]hexan-1-ol?
3-[[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]methyl]hexan-1-ol has a molecular weight of 277.41 g/mol, XLogP of 2.69, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]methyl]hexan-1-ol is sourced from PubChem (CID 106115486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).