C12H17NO2 — CID 66359994
2-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]ethanol (PubChem CID 66359994) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]ethanol.
| Compound Name | 2-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]ethanol |
|---|---|
| PubChem CID | 66359994 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]ethanol |
| SMILES | Cc1ccc2c(c1)CC(CNCCO)O2 |
| InChI | InChI=1S/C12H17NO2/c1-9-2-3-12-10(6-9)7-11(15-12)8-13-4-5-14/h2-3,6,11,13-14H,4-5,7-8H2,1H3 |
| InChIKey | CGAACYUSGSDNCU-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|