C13H18N2O2 — CID 66361152
3-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]propanamide (PubChem CID 66361152) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 3-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]propanamide.
| Compound Name | 3-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]propanamide |
|---|---|
| PubChem CID | 66361152 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 3-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]propanamide |
| SMILES | Cc1ccc2c(c1)CC(CNCCC(N)=O)O2 |
| InChI | InChI=1S/C13H18N2O2/c1-9-2-3-12-10(6-9)7-11(17-12)8-15-5-4-13(14)16/h2-3,6,11,15H,4-5,7-8H2,1H3,(H2,14,16) |
| InChIKey | UYCPTONWSJNIIN-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|