3-(5-methyl-2,3-dihydro-1-benzofuran-2-yl)propanoic acid

C12H14O3 — CID 66360253

IUPAC3-(5-methyl-2,3-dihydro-1-benzofuran-2-yl)propanoic acid
SMILESCc1ccc2c(c1)CC(CCC(=O)O)O2
InChIInChI=1S/C12H14O3/c1-8-2-4-11-9(6-8)7-10(15-11)3-5-12(13)14/h2,4,6,10H,3,5,7H2,1H3,(H,13,14)
InChIKeyGAZOAOQWMGWPMY-UHFFFAOYSA-N
MW206.24 g/mol
LogP2.16
Rot. Bonds3

About 3-(5-methyl-2,3-dihydro-1-benzofuran-2-yl)propanoic acid

3-(5-methyl-2,3-dihydro-1-benzofuran-2-yl)propanoic acid (PubChem CID 66360253) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 3-(5-methyl-2,3-dihydro-1-benzofuran-2-yl)propanoic acid.

Molecular Properties

Compound Name3-(5-methyl-2,3-dihydro-1-benzofuran-2-yl)propanoic acid
PubChem CID66360253
Molecular FormulaC12H14O3
Molecular Weight206.24 g/mol
Exact Mass206.09
IUPAC Name3-(5-methyl-2,3-dihydro-1-benzofuran-2-yl)propanoic acid
SMILESCc1ccc2c(c1)CC(CCC(=O)O)O2
InChIInChI=1S/C12H14O3/c1-8-2-4-11-9(6-8)7-10(15-11)3-5-12(13)14/h2,4,6,10H,3,5,7H2,1H3,(H,13,14)
InChIKeyGAZOAOQWMGWPMY-UHFFFAOYSA-N
XLogP2.16
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.24
LogP ≤ 52.16
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-(5-methyl-2,3-dihydro-1-benzofuran-2-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(5-methyl-2,3-dihydro-1-benzofuran-2-yl)propanoic acid?
The IUPAC name of 3-(5-methyl-2,3-dihydro-1-benzofuran-2-yl)propanoic acid (CID 66360253) is 3-(5-methyl-2,3-dihydro-1-benzofuran-2-yl)propanoic acid.
What is the SMILES notation for 3-(5-methyl-2,3-dihydro-1-benzofuran-2-yl)propanoic acid?
The canonical SMILES for 3-(5-methyl-2,3-dihydro-1-benzofuran-2-yl)propanoic acid is Cc1ccc2c(c1)CC(CCC(=O)O)O2.
What is the InChIKey of 3-(5-methyl-2,3-dihydro-1-benzofuran-2-yl)propanoic acid?
The InChIKey is GAZOAOQWMGWPMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O3/c1-8-2-4-11-9(6-8)7-10(15-11)3-5-12(13)14/h2,4,6,10H,3,5,7H2,1H3,(H,13,14).
What are the key properties of 3-(5-methyl-2,3-dihydro-1-benzofuran-2-yl)propanoic acid?
3-(5-methyl-2,3-dihydro-1-benzofuran-2-yl)propanoic acid has a molecular weight of 206.24 g/mol, XLogP of 2.16, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-methyl-2,3-dihydro-1-benzofuran-2-yl)propanoic acid is sourced from PubChem (CID 66360253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).