2-[(2R)-6-methyl-3,4-dihydro-2H-chromen-2-yl]acetic acid

C12H14O3 — CID 147031963

IUPAC2-[(2R)-6-methyl-3,4-dihydro-2H-chromen-2-yl]acetic acid
SMILESCc1ccc2c(c1)CC[C@H](CC(=O)O)O2
InChIInChI=1S/C12H14O3/c1-8-2-5-11-9(6-8)3-4-10(15-11)7-12(13)14/h2,5-6,10H,3-4,7H2,1H3,(H,13,14)/t10-/m1/s1
InChIKeyAXTRRFKLQZZCFD-SNVBAGLBSA-N
MW206.24 g/mol
LogP2.16
Rot. Bonds2

About 2-[(2R)-6-methyl-3,4-dihydro-2H-chromen-2-yl]acetic acid

2-[(2R)-6-methyl-3,4-dihydro-2H-chromen-2-yl]acetic acid (PubChem CID 147031963) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-[(2R)-6-methyl-3,4-dihydro-2H-chromen-2-yl]acetic acid.

Molecular Properties

Compound Name2-[(2R)-6-methyl-3,4-dihydro-2H-chromen-2-yl]acetic acid
PubChem CID147031963
Molecular FormulaC12H14O3
Molecular Weight206.24 g/mol
Exact Mass206.09
IUPAC Name2-[(2R)-6-methyl-3,4-dihydro-2H-chromen-2-yl]acetic acid
SMILESCc1ccc2c(c1)CC[C@H](CC(=O)O)O2
InChIInChI=1S/C12H14O3/c1-8-2-5-11-9(6-8)3-4-10(15-11)7-12(13)14/h2,5-6,10H,3-4,7H2,1H3,(H,13,14)/t10-/m1/s1
InChIKeyAXTRRFKLQZZCFD-SNVBAGLBSA-N
XLogP2.16
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.24
LogP ≤ 52.16
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[(2R)-6-methyl-3,4-dihydro-2H-chromen-2-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2R)-6-methyl-3,4-dihydro-2H-chromen-2-yl]acetic acid?
The IUPAC name of 2-[(2R)-6-methyl-3,4-dihydro-2H-chromen-2-yl]acetic acid (CID 147031963) is 2-[(2R)-6-methyl-3,4-dihydro-2H-chromen-2-yl]acetic acid.
What is the SMILES notation for 2-[(2R)-6-methyl-3,4-dihydro-2H-chromen-2-yl]acetic acid?
The canonical SMILES for 2-[(2R)-6-methyl-3,4-dihydro-2H-chromen-2-yl]acetic acid is Cc1ccc2c(c1)CC[C@H](CC(=O)O)O2.
What is the InChIKey of 2-[(2R)-6-methyl-3,4-dihydro-2H-chromen-2-yl]acetic acid?
The InChIKey is AXTRRFKLQZZCFD-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H14O3/c1-8-2-5-11-9(6-8)3-4-10(15-11)7-12(13)14/h2,5-6,10H,3-4,7H2,1H3,(H,13,14)/t10-/m1/s1.
What are the key properties of 2-[(2R)-6-methyl-3,4-dihydro-2H-chromen-2-yl]acetic acid?
2-[(2R)-6-methyl-3,4-dihydro-2H-chromen-2-yl]acetic acid has a molecular weight of 206.24 g/mol, XLogP of 2.16, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R)-6-methyl-3,4-dihydro-2H-chromen-2-yl]acetic acid is sourced from PubChem (CID 147031963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).