C12H16ClNO3 — CID 157401731
methyl 2-(6-amino-3,4-dihydro-2H-chromen-2-yl)acetate;hydrochloride (PubChem CID 157401731) has the molecular formula C12H16ClNO3 and a molecular weight of 257.72 g/mol. Its IUPAC name is methyl 2-(6-amino-3,4-dihydro-2H-chromen-2-yl)acetate;hydrochloride.
| Compound Name | methyl 2-(6-amino-3,4-dihydro-2H-chromen-2-yl)acetate;hydrochloride |
|---|---|
| PubChem CID | 157401731 |
| Molecular Formula | C12H16ClNO3 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | methyl 2-(6-amino-3,4-dihydro-2H-chromen-2-yl)acetate;hydrochloride |
| SMILES | COC(=O)CC1CCc2cc(N)ccc2O1.Cl |
| InChI | InChI=1S/C12H15NO3.ClH/c1-15-12(14)7-10-4-2-8-6-9(13)3-5-11(8)16-10;/h3,5-6,10H,2,4,7,13H2,1H3;1H |
| InChIKey | ZQIIXMAGGZPFJB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|