C13H20N2O — CID 163794602
2-(3-aminobutyl)-3,4-dihydro-2H-chromen-6-amine (PubChem CID 163794602) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 2-(3-aminobutyl)-3,4-dihydro-2H-chromen-6-amine.
| Compound Name | 2-(3-aminobutyl)-3,4-dihydro-2H-chromen-6-amine |
|---|---|
| PubChem CID | 163794602 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 2-(3-aminobutyl)-3,4-dihydro-2H-chromen-6-amine |
| SMILES | CC(N)CCC1CCc2cc(N)ccc2O1 |
| InChI | InChI=1S/C13H20N2O/c1-9(14)2-5-12-6-3-10-8-11(15)4-7-13(10)16-12/h4,7-9,12H,2-3,5-6,14-15H2,1H3 |
| InChIKey | MZRWALLYBYGJHW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|