C17H31NO — CID 142100009
2,2-dimethylpropane;ethane;(2R)-2-methyl-3,4-dihydro-2H-chromen-6-amine (PubChem CID 142100009) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is 2,2-dimethylpropane;ethane;(2R)-2-methyl-3,4-dihydro-2H-chromen-6-amine.
| Compound Name | 2,2-dimethylpropane;ethane;(2R)-2-methyl-3,4-dihydro-2H-chromen-6-amine |
|---|---|
| PubChem CID | 142100009 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | 2,2-dimethylpropane;ethane;(2R)-2-methyl-3,4-dihydro-2H-chromen-6-amine |
| SMILES | CC.CC(C)(C)C.C[C@@H]1CCc2cc(N)ccc2O1 |
| InChI | InChI=1S/C10H13NO.C5H12.C2H6/c1-7-2-3-8-6-9(11)4-5-10(8)12-7;1-5(2,3)4;1-2/h4-7H,2-3,11H2,1H3;1-4H3;1-2H3/t7-;;/m1../s1 |
| InChIKey | IQWFXMXTJBGNOJ-XCUBXKJBSA-N |
| XLogP | 5.06 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|