C15H14FNO — CID 117046583
2-(4-fluorophenyl)-3,4-dihydro-2H-chromen-6-amine (PubChem CID 117046583) has the molecular formula C15H14FNO and a molecular weight of 243.28 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3,4-dihydro-2H-chromen-6-amine.
| Compound Name | 2-(4-fluorophenyl)-3,4-dihydro-2H-chromen-6-amine |
|---|---|
| PubChem CID | 117046583 |
| Molecular Formula | C15H14FNO |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 2-(4-fluorophenyl)-3,4-dihydro-2H-chromen-6-amine |
| SMILES | Nc1ccc2c(c1)CCC(c1ccc(F)cc1)O2 |
| InChI | InChI=1S/C15H14FNO/c16-12-4-1-10(2-5-12)14-7-3-11-9-13(17)6-8-15(11)18-14/h1-2,4-6,8-9,14H,3,7,17H2 |
| InChIKey | VBPHYTNSCXHDBH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|