C15H13ClO — CID 13250352
6-chloro-2-phenyl-3,4-dihydro-2H-chromene (PubChem CID 13250352) has the molecular formula C15H13ClO and a molecular weight of 244.72 g/mol. Its IUPAC name is 6-chloro-2-phenyl-3,4-dihydro-2H-chromene.
| Compound Name | 6-chloro-2-phenyl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 13250352 |
| Molecular Formula | C15H13ClO |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 6-chloro-2-phenyl-3,4-dihydro-2H-chromene |
| SMILES | Clc1ccc2c(c1)CCC(c1ccccc1)O2 |
| InChI | InChI=1S/C15H13ClO/c16-13-7-9-15-12(10-13)6-8-14(17-15)11-4-2-1-3-5-11/h1-5,7,9-10,14H,6,8H2 |
| InChIKey | JUCKELREIXLBHK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |