C11H12FNO — CID 145256711
2-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)aziridine (PubChem CID 145256711) has the molecular formula C11H12FNO and a molecular weight of 193.22 g/mol. Its IUPAC name is 2-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)aziridine.
| Compound Name | 2-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)aziridine |
|---|---|
| PubChem CID | 145256711 |
| Molecular Formula | C11H12FNO |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 2-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)aziridine |
| SMILES | Fc1ccc2c(c1)CCC(C1CN1)O2 |
| InChI | InChI=1S/C11H12FNO/c12-8-2-4-10-7(5-8)1-3-11(14-10)9-6-13-9/h2,4-5,9,11,13H,1,3,6H2 |
| InChIKey | NRMLKMYMQNWZAH-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 31.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|