C10H10BrFO — CID 69246193
2-(bromomethyl)-6-fluoro-3,4-dihydro-2H-chromene (PubChem CID 69246193) has the molecular formula C10H10BrFO and a molecular weight of 245.09 g/mol. Its IUPAC name is 2-(bromomethyl)-6-fluoro-3,4-dihydro-2H-chromene.
| Compound Name | 2-(bromomethyl)-6-fluoro-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 69246193 |
| Molecular Formula | C10H10BrFO |
| Molecular Weight | 245.09 g/mol |
| Exact Mass | 243.99 |
| IUPAC Name | 2-(bromomethyl)-6-fluoro-3,4-dihydro-2H-chromene |
| SMILES | Fc1ccc2c(c1)CCC(CBr)O2 |
| InChI | InChI=1S/C10H10BrFO/c11-6-9-3-1-7-5-8(12)2-4-10(7)13-9/h2,4-5,9H,1,3,6H2 |
| InChIKey | UYDKCUSMTFGMGZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.09 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|