About 1-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)butan-1-ol
1-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)butan-1-ol (PubChem CID 161067218) has the molecular formula C13H17FO2
and a molecular weight of 224.27 g/mol. Its IUPAC name is 1-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)butan-1-ol.
Molecular Properties
| Compound Name | 1-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)butan-1-ol |
| PubChem CID | 161067218 |
| Molecular Formula | C13H17FO2 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 1-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)butan-1-ol |
| SMILES | CCCC(O)C1CCc2cc(F)ccc2O1 |
| InChI | InChI=1S/C13H17FO2/c1-2-3-11(15)13-6-4-9-8-10(14)5-7-12(9)16-13/h5,7-8,11,13,15H,2-4,6H2,1H3 |
| InChIKey | UEEKPMKFCXWWEF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)butan-1-ol?
The IUPAC name of 1-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)butan-1-ol (CID 161067218) is 1-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)butan-1-ol.
What is the SMILES notation for 1-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)butan-1-ol?
The canonical SMILES for 1-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)butan-1-ol is CCCC(O)C1CCc2cc(F)ccc2O1.
What is the InChIKey of 1-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)butan-1-ol?
The InChIKey is UEEKPMKFCXWWEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17FO2/c1-2-3-11(15)13-6-4-9-8-10(14)5-7-12(9)16-13/h5,7-8,11,13,15H,2-4,6H2,1H3.
What are the key properties of 1-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)butan-1-ol?
1-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)butan-1-ol has a molecular weight of 224.27 g/mol, XLogP of 2.68, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)butan-1-ol is sourced from PubChem (CID 161067218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).