C19H21FO2 — CID 158119819
(1S)-1-[(2R)-6-fluoro-3,4-dihydro-2H-chromen-2-yl]-4-phenylbutan-1-ol (PubChem CID 158119819) has the molecular formula C19H21FO2 and a molecular weight of 300.37 g/mol. Its IUPAC name is (1S)-1-[(2R)-6-fluoro-3,4-dihydro-2H-chromen-2-yl]-4-phenylbutan-1-ol.
| Compound Name | (1S)-1-[(2R)-6-fluoro-3,4-dihydro-2H-chromen-2-yl]-4-phenylbutan-1-ol |
|---|---|
| PubChem CID | 158119819 |
| Molecular Formula | C19H21FO2 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | (1S)-1-[(2R)-6-fluoro-3,4-dihydro-2H-chromen-2-yl]-4-phenylbutan-1-ol |
| SMILES | O[C@@H](CCCc1ccccc1)[C@H]1CCc2cc(F)ccc2O1 |
| InChI | InChI=1S/C19H21FO2/c20-16-10-12-18-15(13-16)9-11-19(22-18)17(21)8-4-7-14-5-2-1-3-6-14/h1-3,5-6,10,12-13,17,19,21H,4,7-9,11H2/t17-,19+/m0/s1 |
| InChIKey | MMCMZLZAELWBRT-PKOBYXMFSA-N |
| XLogP | 3.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |