C23H26F2NO3 — CID 58795145
CID 58795145 (PubChem CID 58795145) has the molecular formula C23H26F2NO3 and a molecular weight of 402.46 g/mol.
| Compound Name | CID 58795145 |
|---|---|
| PubChem CID | 58795145 |
| Molecular Formula | C23H26F2NO3 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | — |
| SMILES | C[C@H](C[N]C[C@@H](O)[C@@H]1CCc2cc(F)ccc2O1)C1CCc2cc(F)ccc2O1 |
| InChI | InChI=1S/C23H26F2NO3/c1-14(20-6-2-15-10-17(24)4-8-21(15)28-20)12-26-13-19(27)23-7-3-16-11-18(25)5-9-22(16)29-23/h4-5,8-11,14,19-20,23,27H,2-3,6-7,12-13H2,1H3/t14-,19-,20?,23+/m1/s1 |
| InChIKey | GVETVJUUBJIONJ-XDFXPXTESA-N |
| XLogP | 3.65 |
| TPSA | 52.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |