About 6-fluoro-3,4-dihydro-2H-chromene-2-carboxylic acid;hydrate
6-fluoro-3,4-dihydro-2H-chromene-2-carboxylic acid;hydrate (PubChem CID 141330874) has the molecular formula C10H11FO4
and a molecular weight of 214.19 g/mol. Its IUPAC name is 6-fluoro-3,4-dihydro-2H-chromene-2-carboxylic acid;hydrate.
Analyze 6-fluoro-3,4-dihydro-2H-chromene-2-carboxylic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-3,4-dihydro-2H-chromene-2-carboxylic acid;hydrate?
The IUPAC name of 6-fluoro-3,4-dihydro-2H-chromene-2-carboxylic acid;hydrate (CID 141330874) is 6-fluoro-3,4-dihydro-2H-chromene-2-carboxylic acid;hydrate.
What is the SMILES notation for 6-fluoro-3,4-dihydro-2H-chromene-2-carboxylic acid;hydrate?
The canonical SMILES for 6-fluoro-3,4-dihydro-2H-chromene-2-carboxylic acid;hydrate is O.O=C(O)C1CCc2cc(F)ccc2O1.
What is the InChIKey of 6-fluoro-3,4-dihydro-2H-chromene-2-carboxylic acid;hydrate?
The InChIKey is JUIAVFYETZTGMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FO3.H2O/c11-7-2-4-8-6(5-7)1-3-9(14-8)10(12)13;/h2,4-5,9H,1,3H2,(H,12,13);1H2.
What are the key properties of 6-fluoro-3,4-dihydro-2H-chromene-2-carboxylic acid;hydrate?
6-fluoro-3,4-dihydro-2H-chromene-2-carboxylic acid;hydrate has a molecular weight of 214.19 g/mol, XLogP of 0.78, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-3,4-dihydro-2H-chromene-2-carboxylic acid;hydrate is sourced from PubChem (CID 141330874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).