C13H16ClFO2 — CID 143652551
2-chloro-1-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)ethanone;ethane (PubChem CID 143652551) has the molecular formula C13H16ClFO2 and a molecular weight of 258.72 g/mol. Its IUPAC name is 2-chloro-1-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)ethanone;ethane.
| Compound Name | 2-chloro-1-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)ethanone;ethane |
|---|---|
| PubChem CID | 143652551 |
| Molecular Formula | C13H16ClFO2 |
| Molecular Weight | 258.72 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 2-chloro-1-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)ethanone;ethane |
| SMILES | CC.O=C(CCl)C1CCc2cc(F)ccc2O1 |
| InChI | InChI=1S/C11H10ClFO2.C2H6/c12-6-9(14)11-3-1-7-5-8(13)2-4-10(7)15-11;1-2/h2,4-5,11H,1,3,6H2;1-2H3 |
| InChIKey | KHZJIOLFAIMJOI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.72 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|