C29H31F2NO3 — CID 145124833
2-[benzyl-[5-(5-fluoro-2-hydroxyphenyl)pentyl]amino]-1-[(2R)-6-fluoro-3,4-dihydro-2H-chromen-2-yl]ethanone (PubChem CID 145124833) has the molecular formula C29H31F2NO3 and a molecular weight of 479.57 g/mol. Its IUPAC name is 2-[benzyl-[5-(5-fluoro-2-hydroxyphenyl)pentyl]amino]-1-[(2R)-6-fluoro-3,4-dihydro-2H-chromen-2-yl]ethanone.
| Compound Name | 2-[benzyl-[5-(5-fluoro-2-hydroxyphenyl)pentyl]amino]-1-[(2R)-6-fluoro-3,4-dihydro-2H-chromen-2-yl]ethanone |
|---|---|
| PubChem CID | 145124833 |
| Molecular Formula | C29H31F2NO3 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | 2-[benzyl-[5-(5-fluoro-2-hydroxyphenyl)pentyl]amino]-1-[(2R)-6-fluoro-3,4-dihydro-2H-chromen-2-yl]ethanone |
| SMILES | O=C(CN(CCCCCc1cc(F)ccc1O)Cc1ccccc1)[C@H]1CCc2cc(F)ccc2O1 |
| InChI | InChI=1S/C29H31F2NO3/c30-24-11-13-26(33)22(17-24)9-5-2-6-16-32(19-21-7-3-1-4-8-21)20-27(34)29-14-10-23-18-25(31)12-15-28(23)35-29/h1,3-4,7-8,11-13,15,17-18,29,33H,2,5-6,9-10,14,16,19-20H2/t29-/m1/s1 |
| InChIKey | HSKOFBISLRGXJP-GDLZYMKVSA-N |
| XLogP | 5.85 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|