C19H19FO4 — CID 163392785
6-[3-(4-fluorophenoxy)propyl]-3,4-dihydro-2H-chromene-2-carboxylic acid (PubChem CID 163392785) has the molecular formula C19H19FO4 and a molecular weight of 330.36 g/mol. Its IUPAC name is 6-[3-(4-fluorophenoxy)propyl]-3,4-dihydro-2H-chromene-2-carboxylic acid.
| Compound Name | 6-[3-(4-fluorophenoxy)propyl]-3,4-dihydro-2H-chromene-2-carboxylic acid |
|---|---|
| PubChem CID | 163392785 |
| Molecular Formula | C19H19FO4 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 6-[3-(4-fluorophenoxy)propyl]-3,4-dihydro-2H-chromene-2-carboxylic acid |
| SMILES | O=C(O)C1CCc2cc(CCCOc3ccc(F)cc3)ccc2O1 |
| InChI | InChI=1S/C19H19FO4/c20-15-5-7-16(8-6-15)23-11-1-2-13-3-9-17-14(12-13)4-10-18(24-17)19(21)22/h3,5-9,12,18H,1-2,4,10-11H2,(H,21,22) |
| InChIKey | OBMKYYKLSXUCTN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|