C19H26O5 — CID 163392743
methyl 6-[3-(oxan-2-yloxy)propyl]-3,4-dihydro-2H-chromene-2-carboxylate (PubChem CID 163392743) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is methyl 6-[3-(oxan-2-yloxy)propyl]-3,4-dihydro-2H-chromene-2-carboxylate.
| Compound Name | methyl 6-[3-(oxan-2-yloxy)propyl]-3,4-dihydro-2H-chromene-2-carboxylate |
|---|---|
| PubChem CID | 163392743 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | methyl 6-[3-(oxan-2-yloxy)propyl]-3,4-dihydro-2H-chromene-2-carboxylate |
| SMILES | COC(=O)C1CCc2cc(CCCOC3CCCCO3)ccc2O1 |
| InChI | InChI=1S/C19H26O5/c1-21-19(20)17-10-8-15-13-14(7-9-16(15)24-17)5-4-12-23-18-6-2-3-11-22-18/h7,9,13,17-18H,2-6,8,10-12H2,1H3 |
| InChIKey | PXSMSAHIHNJFPC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|