C24H28O4 — CID 10022678
methyl 4-[(E)-2-[3-[3-(oxan-2-yloxy)propyl]phenyl]ethenyl]benzoate (PubChem CID 10022678) has the molecular formula C24H28O4 and a molecular weight of 380.48 g/mol. Its IUPAC name is methyl 4-[(E)-2-[3-[3-(oxan-2-yloxy)propyl]phenyl]ethenyl]benzoate.
| Compound Name | methyl 4-[(E)-2-[3-[3-(oxan-2-yloxy)propyl]phenyl]ethenyl]benzoate |
|---|---|
| PubChem CID | 10022678 |
| Molecular Formula | C24H28O4 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | methyl 4-[(E)-2-[3-[3-(oxan-2-yloxy)propyl]phenyl]ethenyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C/c2cccc(CCCOC3CCCCO3)c2)cc1 |
| InChI | InChI=1S/C24H28O4/c1-26-24(25)22-14-12-19(13-15-22)10-11-21-7-4-6-20(18-21)8-5-17-28-23-9-2-3-16-27-23/h4,6-7,10-15,18,23H,2-3,5,8-9,16-17H2,1H3/b11-10+ |
| InChIKey | BDGFOKGVCCZNDE-ZHACJKMWSA-N |
| XLogP | 5.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|