C24H30O4 — CID 10452492
methyl 2-[3-[[3-[3-(oxan-2-yloxy)propyl]phenyl]methyl]phenyl]acetate (PubChem CID 10452492) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is methyl 2-[3-[[3-[3-(oxan-2-yloxy)propyl]phenyl]methyl]phenyl]acetate.
| Compound Name | methyl 2-[3-[[3-[3-(oxan-2-yloxy)propyl]phenyl]methyl]phenyl]acetate |
|---|---|
| PubChem CID | 10452492 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | methyl 2-[3-[[3-[3-(oxan-2-yloxy)propyl]phenyl]methyl]phenyl]acetate |
| SMILES | COC(=O)Cc1cccc(Cc2cccc(CCCOC3CCCCO3)c2)c1 |
| InChI | InChI=1S/C24H30O4/c1-26-23(25)18-22-10-5-9-21(17-22)16-20-8-4-7-19(15-20)11-6-14-28-24-12-2-3-13-27-24/h4-5,7-10,15,17,24H,2-3,6,11-14,16,18H2,1H3 |
| InChIKey | UJEFXDGFOXFHIH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|