C27H34O5 — CID 146792534
1,3-bis[3-(oxan-2-yloxymethyl)phenyl]propan-2-one (PubChem CID 146792534) has the molecular formula C27H34O5 and a molecular weight of 438.56 g/mol. Its IUPAC name is 1,3-bis[3-(oxan-2-yloxymethyl)phenyl]propan-2-one.
| Compound Name | 1,3-bis[3-(oxan-2-yloxymethyl)phenyl]propan-2-one |
|---|---|
| PubChem CID | 146792534 |
| Molecular Formula | C27H34O5 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 1,3-bis[3-(oxan-2-yloxymethyl)phenyl]propan-2-one |
| SMILES | O=C(Cc1cccc(COC2CCCCO2)c1)Cc1cccc(COC2CCCCO2)c1 |
| InChI | InChI=1S/C27H34O5/c28-25(17-21-7-5-9-23(15-21)19-31-26-11-1-3-13-29-26)18-22-8-6-10-24(16-22)20-32-27-12-2-4-14-30-27/h5-10,15-16,26-27H,1-4,11-14,17-20H2 |
| InChIKey | RWCRBASLAFMFSG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |